CAS 37700-64-4 appears in our catalog under these names: Z-Phe-Gly-Gly-OH, 98%, ((Benzyloxy)carbonyl)-L-phenylalanylglycylglycine, 97%, 97%, Cbz-Phe-Gly-Gly-OH, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-[[2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]acetic acid (CAS 37700-64-4) is a chemical compound with the molecular formula C21H23N3O6 and a molecular weight of 413.4 g/mol. IUPAC name: 2-[[2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]acetic acid. InChIKey: BKVFAOYJBLSVSK-KRWDZBQOSA-N.
| Molecular formula | C21H23N3O6 |
|---|---|
| Molecular weight | 413.4 g/mol |
| IUPAC name | 2-[[2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetyl]amino]acetic acid |
| InChIKey | BKVFAOYJBLSVSK-KRWDZBQOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)NCC(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)