CAS 13174-37-3 appears in our catalog under these names: 3-((Pyridin-3-ylmethyl)-amino)-benzoic acid, 3-((Pyridin-3-ylmethyl)amino)benzoic acid, 97%, 3-[(Pyridin-3-ylmethyl)-amino]-benzoic acid, 98%, 3-((Pyridin-3-ylmethyl)amino)benzoic acid, 98%. Offered by: Biosynth, AmBeed, Fluorochem, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, 1g, 50mg.
3-(pyridin-3-ylmethylamino)benzoic acid (CAS 13174-37-3) is a chemical compound with the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. IUPAC name: 3-(pyridin-3-ylmethylamino)benzoic acid. InChIKey: FDOXNJWMRVHSSC-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O2 |
|---|---|
| Molecular weight | 228.25 g/mol |
| IUPAC name | 3-(pyridin-3-ylmethylamino)benzoic acid |
| InChIKey | FDOXNJWMRVHSSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC2=CN=CC=C2)C(=O)O |
Computed by PubChem (NCBI)