CAS 131771-46-5 appears in our catalog under these names: D-(1-13C)Xylulose (1M in Water), D-Xylulose-1-13C, 99.22%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg (1 M * 33.09 μL in Water), 10 mg (1 M * 66.17 μL in Water), 25 mg (1 M * 165.43 μL in Water).
(3S,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one (CAS 131771-46-5) is a chemical compound with the molecular formula C5H10O5 and a molecular weight of 151.12 g/mol. IUPAC name: (3S,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one. InChIKey: ZAQJHHRNXZUBTE-HSGPOLEDSA-N.
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | (3S,4R)-1,3,4,5-tetrahydroxy(113C)pentan-2-one |
| InChIKey | ZAQJHHRNXZUBTE-HSGPOLEDSA-N |
| SMILES | C([C@H]([C@@H](C(=O)[13CH2]O)O)O)O |
Computed by PubChem (NCBI)