CAS 5962-29-8 is the registry number for Xylulose. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
D-xylulose is the D-enantiomer of xylulose. It has a role as a mouse metabolite, a Saccharomyces cerevisiae metabolite, an Escherichia coli metabolite and a human metabolite. It is an enantiomer of a L-xylulose.
Source: ChEBI
| Molecular formula | C5H10O5 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | (3S,4R)-1,3,4,5-tetrahydroxypentan-2-one |
| InChIKey | ZAQJHHRNXZUBTE-WUJLRWPWSA-N |
| SMILES | C([C@H]([C@@H](C(=O)CO)O)O)O |
Computed by PubChem (NCBI)