CAS 131802-60-3 appears in our catalog under these names: 7-Benzyloxyquinoline, 95%, 7-Benzyloxyquinoline, >95% (HPLC), 7-Benzyloxyquinoline, 98.50%, 7-(Benzyloxy)quinoline, 97%, 97%, 7-(Benzyloxy)quinoline, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 100mg, 1g, 10mg, 50mg, 5mg, 25mg.
7-phenylmethoxyquinoline (CAS 131802-60-3) is a chemical compound with the molecular formula C16H13NO and a molecular weight of 235.28 g/mol. IUPAC name: 7-phenylmethoxyquinoline. InChIKey: SIDLHXXVIBTSJZ-UHFFFAOYSA-N.
| Molecular formula | C16H13NO |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 7-phenylmethoxyquinoline |
| InChIKey | SIDLHXXVIBTSJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=CC=N3)C=C2 |
Computed by PubChem (NCBI)