CAS 14224-99-8 appears in our catalog under these names: 2-methyl-4,5-diphenyl-1,3-oxazole, 95%, 2–Methyl–4,5–diphenyloxazole, 2-Methyl-4,5-diphenyloxazole, 2-Methyl-4,5-diphenyloxazole, 2-Methyl-4,5-diphenyloxazole, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-methyl-4,5-diphenyl-1,3-oxazole (CAS 14224-99-8) is a chemical compound with the molecular formula C16H13NO and a molecular weight of 235.28 g/mol. IUPAC name: 2-methyl-4,5-diphenyl-1,3-oxazole. InChIKey: QLQIWRCWPJRJJA-UHFFFAOYSA-N.
| Molecular formula | C16H13NO |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | 2-methyl-4,5-diphenyl-1,3-oxazole |
| InChIKey | QLQIWRCWPJRJJA-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(O1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)