CAS 2839502-60-0 is the registry number for 4-Bromothieno[3,2-d]pyrimidin-7-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromothieno[3,2-d]pyrimidin-7-amine (CAS 2839502-60-0) is a chemical compound with the molecular formula C6H4BrN3S and a molecular weight of 230.09 g/mol. IUPAC name: 4-bromothieno[3,2-d]pyrimidin-7-amine. InChIKey: BAYXRTAWWANHGP-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 4-bromothieno[3,2-d]pyrimidin-7-amine |
| InChIKey | BAYXRTAWWANHGP-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Br)N |
Computed by PubChem (NCBI)