CAS 131818-17-2 appears in our catalog under these names: tert–Butyl (4–bromophenyl)carbamate, N-Boc-4-bromoaniline, 97% , tert-Butyl (4-Bromophenyl)carbamate, >97.0%(HPLC)(T), tert-Butyl (4-bromophenyl)carbamate 98%, tert-Butyl (4-bromophenyl)carbamate, 98%, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 100g, 500g, 5g, 25g, 1000g, 1kg, 1g, 10g.
Tert-butyl N-(4-bromophenyl)carbamate (CAS 131818-17-2) is a chemical compound with the molecular formula C11H14BrNO2 and a molecular weight of 272.14 g/mol. IUPAC name: tert-butyl N-(4-bromophenyl)carbamate. InChIKey: VLGPDTPSKUUHKR-UHFFFAOYSA-N.
| Molecular formula | C11H14BrNO2 |
|---|---|
| Molecular weight | 272.14 g/mol |
| IUPAC name | tert-butyl N-(4-bromophenyl)carbamate |
| InChIKey | VLGPDTPSKUUHKR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)