Products 1318208-88-6
CAS 1318208-88-6 is the registry number for AR ligand-48. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-(2-methylpropoxy)-4-[[3-(2-methylpropoxy)-4-nitrobenzoyl]amino]benzoate (CAS 1318208-88-6) is a chemical compound with the molecular formula C23H28N2O7 and a molecular weight of 444.5 g/mol. IUPAC name: methyl 3-(2-methylpropoxy)-4-[[3-(2-methylpropoxy)-4-nitrobenzoyl]amino]benzoate. InChIKey: ILJVPKAGGUAOAT-UHFFFAOYSA-N.
| Molecular formula | C23H28N2O7 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | methyl 3-(2-methylpropoxy)-4-[[3-(2-methylpropoxy)-4-nitrobenzoyl]amino]benzoate |
| InChIKey | ILJVPKAGGUAOAT-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=C(C=CC(=C1)C(=O)OC)NC(=O)C2=CC(=C(C=C2)[N+](=O)[O-])OCC(C)C |
Computed by PubChem (NCBI)