CAS 140430-55-3 appears in our catalog under these names: MCA-PRO-LEU-OH, Mca–PL, (2-(7-Methoxy-2-oxo-2H-chromen-4-yl)acetyl)-L-prolyl-L-leucine, 98%, 98%, Mca-Pro-Leu-OH, 99.10%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 10 mg, 5 mg.
(2S)-2-[[(2S)-1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid (CAS 140430-55-3) is a chemical compound with the molecular formula C23H28N2O7 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-2-[[(2S)-1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid. InChIKey: IWDXAGDGQBGZNX-ROUUACIJSA-N.
| Molecular formula | C23H28N2O7 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-1-[2-(7-methoxy-2-oxochromen-4-yl)acetyl]pyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |
| InChIKey | IWDXAGDGQBGZNX-ROUUACIJSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CC2=CC(=O)OC3=C2C=CC(=C3)OC |
Computed by PubChem (NCBI)