CAS 131829-50-0 appears in our catalog under these names: (S)-3-Amino-3-(thiophen-2-yl)propanoic acid, 97+%, (S)-3-Amino-3-(2-furyl)-propionic acid, 98%, 98%, H-β-D-Ala(thiophen-2-yl)-OH, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
(3S)-3-amino-3-thiophen-2-ylpropanoic acid (CAS 131829-50-0) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: (3S)-3-amino-3-thiophen-2-ylpropanoic acid. InChIKey: GYAYLYLPTPXESE-YFKPBYRVSA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 171.22 g/mol |
| IUPAC name | (3S)-3-amino-3-thiophen-2-ylpropanoic acid |
| InChIKey | GYAYLYLPTPXESE-YFKPBYRVSA-N |
| SMILES | C1=CSC(=C1)[C@H](CC(=O)O)N |
Computed by PubChem (NCBI)