CAS 73495-10-0 appears in our catalog under these names: H-β-Ala-(2-Thienyl)-OH, 96%, (R)-3-Amino-3-(thiophen-2-yl)propanoic acid, 97%, H-β-Ala-(2-Thienyl)-OH, 95%. Offered by: AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-3-amino-3-thiophen-2-ylpropanoic acid (CAS 73495-10-0) is a chemical compound with the molecular formula C7H9NO2S and a molecular weight of 171.22 g/mol. IUPAC name: (3R)-3-amino-3-thiophen-2-ylpropanoic acid. InChIKey: GYAYLYLPTPXESE-RXMQYKEDSA-N.
| Molecular formula | C7H9NO2S |
|---|---|
| Molecular weight | 171.22 g/mol |
| IUPAC name | (3R)-3-amino-3-thiophen-2-ylpropanoic acid |
| InChIKey | GYAYLYLPTPXESE-RXMQYKEDSA-N |
| SMILES | C1=CSC(=C1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)