CAS 131844-40-1 is the registry number for rac-(1R,2S)-N-Methyl-2-phenylcyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Trans-(1R,2S)-N-methyl-2-phenylcyclopropan-1-amine;hydrochloride (CAS 131844-40-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: trans-(1R,2S)-N-methyl-2-phenylcyclopropan-1-amine;hydrochloride. InChIKey: IMUOMBQOBYEIIY-BAUSSPIASA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | trans-(1R,2S)-N-methyl-2-phenylcyclopropan-1-amine;hydrochloride |
| InChIKey | IMUOMBQOBYEIIY-BAUSSPIASA-N |
| SMILES | CN[C@@H]1C[C@H]1C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)