Products 1318785-37-3
CAS 1318785-37-3 is the registry number for Aldol®, 470 acetate, Biosynth Patent: EP 2427431 and US 8940909. Offered by: Biosynth. Available pack sizes: 2,5g, 1g, 5g, 10g.
[1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] acetate (CAS 1318785-37-3) is a chemical compound with the molecular formula C25H21NO5 and a molecular weight of 415.4 g/mol. IUPAC name: [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] acetate. InChIKey: FXZJDQQSFKBSTP-UHFFFAOYSA-N.
| Molecular formula | C25H21NO5 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | [1-[2-(2,4-dimethoxybenzoyl)phenyl]indol-3-yl] acetate |
| InChIKey | FXZJDQQSFKBSTP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CN(C2=CC=CC=C21)C3=CC=CC=C3C(=O)C4=C(C=C(C=C4)OC)OC |
Computed by PubChem (NCBI)