CAS 2712178-59-9 is the registry number for TMV-IN-15. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-benzyl-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxy-N-methylacetamide (CAS 2712178-59-9) is a chemical compound with the molecular formula C25H21NO5 and a molecular weight of 415.4 g/mol. IUPAC name: N-benzyl-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxy-N-methylacetamide. InChIKey: CXJLRYCFOQKBNN-UHFFFAOYSA-N.
| Molecular formula | C25H21NO5 |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | N-benzyl-2-(5-hydroxy-4-oxo-2-phenylchromen-7-yl)oxy-N-methylacetamide |
| InChIKey | CXJLRYCFOQKBNN-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C(=O)COC2=CC(=C3C(=C2)OC(=CC3=O)C4=CC=CC=C4)O |
Computed by PubChem (NCBI)