Products 13191-44-1
CAS 13191-44-1 is the registry number for 5-Cyclohexylthiophene-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-cyclohexylthiophene-3-carboxylic acid (CAS 13191-44-1) is a chemical compound with the molecular formula C11H14O2S and a molecular weight of 210.29 g/mol. IUPAC name: 5-cyclohexylthiophene-3-carboxylic acid. InChIKey: IXCCTDMPNWUNBK-UHFFFAOYSA-N.
| Molecular formula | C11H14O2S |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | 5-cyclohexylthiophene-3-carboxylic acid |
| InChIKey | IXCCTDMPNWUNBK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=CC(=CS2)C(=O)O |
Computed by PubChem (NCBI)