CAS 131912-34-0 is the registry number for 1-(4-Methylbenzenesulfonyl)pyrrolidin-3-yl 4-methylbenzene-1-sulfonate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
[1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate (CAS 131912-34-0) is a chemical compound with the molecular formula C18H21NO5S2 and a molecular weight of 395.5 g/mol. IUPAC name: [1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate. InChIKey: YLPLVVAXXZWTIR-UHFFFAOYSA-N.
| Molecular formula | C18H21NO5S2 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | [1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate |
| InChIKey | YLPLVVAXXZWTIR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(C2)OS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)