CAS 133034-01-2 appears in our catalog under these names: (S)-1-tosylpyrrolidin-3-yl 4-methylbenzenesulfonate, 98%, (3S)-1-(4-methylbenzenesulfonyl)pyrrolidin-3-yl 4-methylbenzene-1-sulfonate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
[(3S)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate (CAS 133034-01-2) is a chemical compound with the molecular formula C18H21NO5S2 and a molecular weight of 395.5 g/mol. IUPAC name: [(3S)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate. InChIKey: YLPLVVAXXZWTIR-INIZCTEOSA-N.
| Molecular formula | C18H21NO5S2 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | [(3S)-1-(4-methylphenyl)sulfonylpyrrolidin-3-yl] 4-methylbenzenesulfonate |
| InChIKey | YLPLVVAXXZWTIR-INIZCTEOSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC[C@@H](C2)OS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)