CAS 339114-86-2 is the registry number for Chlorphenamine Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-chlorophenyl)-2-(6-chloro-2-pyridinyl)acetonitrile (CAS 339114-86-2) is a chemical compound with the molecular formula C13H8Cl2N2 and a molecular weight of 263.12 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-(6-chloro-2-pyridinyl)acetonitrile. InChIKey: KFUYTJBERFHHIL-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2N2 |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-(6-chloro-2-pyridinyl)acetonitrile |
| InChIKey | KFUYTJBERFHHIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Cl)C(C#N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)