CAS 131971-24-9 appears in our catalog under these names: 2-[(4-Hydroxy-3-nitrobenzene)sulfonamido]benzoic acid, 95%, 2-(4-Hydroxy-3-nitrophenylsulfonamido)benzoic acid, 98%, 2-(4-hydroxy-3-nitrobenzenesulfonamido)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 100mg, 0,5g.
2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid (CAS 131971-24-9) is a chemical compound with the molecular formula C13H10N2O7S and a molecular weight of 338.29 g/mol. IUPAC name: 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: KJEWEPKDQIOROF-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O7S |
|---|---|
| Molecular weight | 338.29 g/mol |
| IUPAC name | 2-[(4-hydroxy-3-nitrophenyl)sulfonylamino]benzoic acid |
| InChIKey | KJEWEPKDQIOROF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NS(=O)(=O)C2=CC(=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)