CAS 62547-13-1 is the registry number for Sulpiride Impurity 27. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-hydroxy-5-[(3-nitrophenyl)sulfamoyl]benzoic acid (CAS 62547-13-1) is a chemical compound with the molecular formula C13H10N2O7S and a molecular weight of 338.29 g/mol. IUPAC name: 2-hydroxy-5-[(3-nitrophenyl)sulfamoyl]benzoic acid. InChIKey: VDRYXYGLISRSAY-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O7S |
|---|---|
| Molecular weight | 338.29 g/mol |
| IUPAC name | 2-hydroxy-5-[(3-nitrophenyl)sulfamoyl]benzoic acid |
| InChIKey | VDRYXYGLISRSAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NS(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)