CAS 132-17-2 appears in our catalog under these names: Benztropine Mesylate, Diphenhydramine Impurity 4, Benzotropine Mesylate, >95% (HPLC), Benztropine Mesilate, Benztropine mesylate/ 99.52% (existing batch purity). Offered by: Chemat Brand, TRC, Mikromol, LoGiCal, TargetMol. Available pack sizes: on request, 100mg, 10mg, 50mg, 250mg, 500mg, 10mM (in 1ml dmso), 1g.
(1R,5S)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid (CAS 132-17-2) is a chemical compound with the molecular formula C22H29NO4S and a molecular weight of 403.5 g/mol. IUPAC name: (1R,5S)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid. InChIKey: CPFJLLXFNPCTDW-IIPFOPBBSA-N.
| Molecular formula | C22H29NO4S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (1R,5S)-3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane;methanesulfonic acid |
| InChIKey | CPFJLLXFNPCTDW-IIPFOPBBSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(C3=CC=CC=C3)C4=CC=CC=C4.CS(=O)(=O)O |
Computed by PubChem (NCBI)