CAS 2757333-37-0 appears in our catalog under these names: ADS032, 98%, ADS032/ 99.33% (existing batch purity), ADS032, ADS032 98%, ADS032, 99.74%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
4-[4-[4-(dipropylsulfamoyl)phenyl]phenyl]butanoic acid (CAS 2757333-37-0) is a chemical compound with the molecular formula C22H29NO4S and a molecular weight of 403.5 g/mol. IUPAC name: 4-[4-[4-(dipropylsulfamoyl)phenyl]phenyl]butanoic acid. InChIKey: UNMDICXGCNPMPK-UHFFFAOYSA-N.
| Molecular formula | C22H29NO4S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 4-[4-[4-(dipropylsulfamoyl)phenyl]phenyl]butanoic acid |
| InChIKey | UNMDICXGCNPMPK-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)CCCC(=O)O |
Computed by PubChem (NCBI)