CAS 132018-13-4 appears in our catalog under these names: 6-Methoxy-3-(methoxycarbonyl)-2-(4-nitrophenyl)-4H-benzopyran-4-one, 6–Methoxy–3–(methoxycarbonyl)–2–(4–nitrophenyl)–4H–benzopyran–4–one. Offered by: TRC, GLPBio. Available pack sizes: 100mg, 250mg, 50mg, 500mg.
Methyl 6-methoxy-2-(4-nitrophenyl)-4-oxochromene-3-carboxylate (CAS 132018-13-4) is a chemical compound with the molecular formula C18H13NO7 and a molecular weight of 355.3 g/mol. IUPAC name: methyl 6-methoxy-2-(4-nitrophenyl)-4-oxochromene-3-carboxylate. InChIKey: BJLXUOUDXYTEOD-UHFFFAOYSA-N.
| Molecular formula | C18H13NO7 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | methyl 6-methoxy-2-(4-nitrophenyl)-4-oxochromene-3-carboxylate |
| InChIKey | BJLXUOUDXYTEOD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C(C2=O)C(=O)OC)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)