CAS 96561-44-3 is the registry number for D-Threo-(3, 4-dihydroxyphenyl)serine. Offered by: TRC. Available pack sizes: 100mg.
(2S,3R)-3-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid (CAS 96561-44-3) is a chemical compound with the molecular formula C18H13NO7 and a molecular weight of 355.3 g/mol. IUPAC name: (2S,3R)-3-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid. InChIKey: ZMFOCUAXRJOPCJ-LSDHHAIUSA-N.
| Molecular formula | C18H13NO7 |
|---|---|
| Molecular weight | 355.3 g/mol |
| IUPAC name | (2S,3R)-3-(1,3-benzodioxol-5-yl)-2-(1,3-dioxoisoindol-2-yl)-3-hydroxypropanoic acid |
| InChIKey | ZMFOCUAXRJOPCJ-LSDHHAIUSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)[C@H]([C@@H](C(=O)O)N3C(=O)C4=CC=CC=C4C3=O)O |
Computed by PubChem (NCBI)