CAS 132034-89-0 appears in our catalog under these names: 4–Iododibenzothiophene, 4-Iododibenzothiophene, 4-Iododibenzothiophene, >98.0%(GC), 4-Iododibenzo[b,d]thiophene 98%, 4-Iododibenzo[b,d]thiophene, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 0,25kg, 0,1kg, 1g, 250mg, 100g.
4-iododibenzothiophene (CAS 132034-89-0) is a chemical compound with the molecular formula C12H7IS and a molecular weight of 310.15 g/mol. IUPAC name: 4-iododibenzothiophene. InChIKey: SKILYZCQRUBEIH-UHFFFAOYSA-N.
| Molecular formula | C12H7IS |
|---|---|
| Molecular weight | 310.15 g/mol |
| IUPAC name | 4-iododibenzothiophene |
| InChIKey | SKILYZCQRUBEIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C(=CC=C3)I |
Computed by PubChem (NCBI)