CAS 177586-41-3 appears in our catalog under these names: 2-Iododibenzothiophene, 95%, 2–Iododibenzothiophene, 2-Iododibenzothiophene, 2-Iododibenzothiophene, >98.0%(GC), 2-Iododibenzo[b,d]thiophene 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 200mg, 1g, 50g, 100mg, 250mg.
2-iododibenzothiophene (CAS 177586-41-3) is a chemical compound with the molecular formula C12H7IS and a molecular weight of 310.15 g/mol. IUPAC name: 2-iododibenzothiophene. InChIKey: LCTVJYHYWSCJAF-UHFFFAOYSA-N.
| Molecular formula | C12H7IS |
|---|---|
| Molecular weight | 310.15 g/mol |
| IUPAC name | 2-iododibenzothiophene |
| InChIKey | LCTVJYHYWSCJAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=CC(=C3)I |
Computed by PubChem (NCBI)