CAS 132059-52-0 appears in our catalog under these names: 3-Chloro-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone, 98%, 3-Chloro-4-(dibromomethyl)-5-hydroxy-2(5H)-furanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
4-chloro-3-(dibromomethyl)-2-hydroxy-2H-furan-5-one (CAS 132059-52-0) is a chemical compound with the molecular formula C5H3Br2ClO3 and a molecular weight of 306.33 g/mol. IUPAC name: 4-chloro-3-(dibromomethyl)-2-hydroxy-2H-furan-5-one. InChIKey: QQUDLQFPDURWTO-UHFFFAOYSA-N.
| Molecular formula | C5H3Br2ClO3 |
|---|---|
| Molecular weight | 306.33 g/mol |
| IUPAC name | 4-chloro-3-(dibromomethyl)-2-hydroxy-2H-furan-5-one |
| InChIKey | QQUDLQFPDURWTO-UHFFFAOYSA-N |
| SMILES | C1(C(=C(C(=O)O1)Cl)C(Br)Br)O |
Computed by PubChem (NCBI)