CAS 441304-67-2 is the registry number for (2E)-4,4-Dibromo-2-chloro-3-formyl-2-butenoic Acid. Offered by: TRC. Available pack sizes: 25mg.
(E)-4,4-dibromo-2-chloro-3-formylbut-2-enoic acid (CAS 441304-67-2) is a chemical compound with the molecular formula C5H3Br2ClO3 and a molecular weight of 306.33 g/mol. IUPAC name: (E)-4,4-dibromo-2-chloro-3-formylbut-2-enoic acid. InChIKey: IFIPOVTUTZOKGW-NSCUHMNNSA-N.
| Molecular formula | C5H3Br2ClO3 |
|---|---|
| Molecular weight | 306.33 g/mol |
| IUPAC name | (E)-4,4-dibromo-2-chloro-3-formylbut-2-enoic acid |
| InChIKey | IFIPOVTUTZOKGW-NSCUHMNNSA-N |
| SMILES | C(=O)/C(=C(/C(=O)O)\Cl)/C(Br)Br |
Computed by PubChem (NCBI)