Products 132064-28-9
CAS 132064-28-9 is the registry number for 4-(1,3-Benzothiazol-2-yl)benzene-1,2-diamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-benzothiazol-2-yl)benzene-1,2-diamine (CAS 132064-28-9) is a chemical compound with the molecular formula C13H11N3S and a molecular weight of 241.31 g/mol. IUPAC name: 4-(1,3-benzothiazol-2-yl)benzene-1,2-diamine. InChIKey: ICSPQPFVCIHHSE-UHFFFAOYSA-N.
| Molecular formula | C13H11N3S |
|---|---|
| Molecular weight | 241.31 g/mol |
| IUPAC name | 4-(1,3-benzothiazol-2-yl)benzene-1,2-diamine |
| InChIKey | ICSPQPFVCIHHSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC(=C(C=C3)N)N |
Computed by PubChem (NCBI)