CAS 1321513-73-8 is the registry number for ADORA2A/PDE4D-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-phenyl-6-pyridin-4-yl-1,2,4-triazin-3-amine (CAS 1321513-73-8) is a chemical compound with the molecular formula C14H11N5 and a molecular weight of 249.27 g/mol. IUPAC name: 5-phenyl-6-pyridin-4-yl-1,2,4-triazin-3-amine. InChIKey: CTRSWEIROKNMCC-UHFFFAOYSA-N.
| Molecular formula | C14H11N5 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 5-phenyl-6-pyridin-4-yl-1,2,4-triazin-3-amine |
| InChIKey | CTRSWEIROKNMCC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=NC(=N2)N)C3=CC=NC=C3 |
Computed by PubChem (NCBI)