CAS 298217-94-4 is the registry number for 2-{((1H-1,2,3-benzotriazol-1-yl)methyl)amino}benzonitrile, 90%. Offered by: AmBeed. Available pack sizes: 1g.
2-(benzotriazol-1-ylmethylamino)benzonitrile (CAS 298217-94-4) is a chemical compound with the molecular formula C14H11N5 and a molecular weight of 249.27 g/mol. IUPAC name: 2-(benzotriazol-1-ylmethylamino)benzonitrile. InChIKey: XKKURCHWFDDYSL-UHFFFAOYSA-N.
| Molecular formula | C14H11N5 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 2-(benzotriazol-1-ylmethylamino)benzonitrile |
| InChIKey | XKKURCHWFDDYSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)NCN2C3=CC=CC=C3N=N2 |
Computed by PubChem (NCBI)