CAS 1321517-51-4 is the registry number for 6-Bromo-5-phenyl-1,2,4-triazin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-bromo-5-phenyl-1,2,4-triazin-3-amine (CAS 1321517-51-4) is a chemical compound with the molecular formula C9H7BrN4 and a molecular weight of 251.08 g/mol. IUPAC name: 6-bromo-5-phenyl-1,2,4-triazin-3-amine. InChIKey: HDABPGYKVQWCNG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN4 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 6-bromo-5-phenyl-1,2,4-triazin-3-amine |
| InChIKey | HDABPGYKVQWCNG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=NC(=N2)N)Br |
Computed by PubChem (NCBI)