CAS 886497-10-5 is the registry number for 5-(3-Bromophenyl)-1,2,4-triazin-3-amine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
5-(3-bromophenyl)-1,2,4-triazin-3-amine (CAS 886497-10-5) is a chemical compound with the molecular formula C9H7BrN4 and a molecular weight of 251.08 g/mol. IUPAC name: 5-(3-bromophenyl)-1,2,4-triazin-3-amine. InChIKey: DARAPQTZAJNROL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN4 |
|---|---|
| Molecular weight | 251.08 g/mol |
| IUPAC name | 5-(3-bromophenyl)-1,2,4-triazin-3-amine |
| InChIKey | DARAPQTZAJNROL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)