CAS 132154-13-3 is the registry number for (1R)-5-Methoxyindanylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine (CAS 132154-13-3) is a chemical compound with the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. IUPAC name: (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine. InChIKey: BIYHMCGHGLLTIN-SNVBAGLBSA-N.
| Molecular formula | C10H13NO |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | (1R)-5-methoxy-2,3-dihydro-1H-inden-1-amine |
| InChIKey | BIYHMCGHGLLTIN-SNVBAGLBSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](CC2)N |
Computed by PubChem (NCBI)