Products 132185-83-2
CAS 132185-83-2 appears in our catalog under these names: 5α–Hydroxycostic acid, 5α-Hydroxycostic acid, 5α-Hydroxycostic acid, 95.17%, 5α-Hydroxycostic acid, 95.03%, 5α-Hydroxycostic acid, 96.5%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 10 mg, 5 mg, 1 mg, 1mg.
2-[(2R,4aR,8aR)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid (CAS 132185-83-2) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: 2-[(2R,4aR,8aR)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid. InChIKey: UEQIFFFWXPAQCB-BPLDGKMQSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | 2-[(2R,4aR,8aR)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoic acid |
| InChIKey | UEQIFFFWXPAQCB-BPLDGKMQSA-N |
| SMILES | C[C@]12CCCC(=C)[C@@]1(C[C@@H](CC2)C(=C)C(=O)O)O |
Computed by PubChem (NCBI)