Products 132198-31-3
CAS 132198-31-3 is the registry number for N-Diphenylmethyl 2,5-anhydro-2,5-imino-D-glucitol. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
(2R,5S)-1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol (CAS 132198-31-3) is a chemical compound with the molecular formula C19H23NO4 and a molecular weight of 329.4 g/mol. IUPAC name: (2R,5S)-1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol. InChIKey: VWTMBCHKRFCFFM-CCZBSFLLSA-N.
| Molecular formula | C19H23NO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | (2R,5S)-1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| InChIKey | VWTMBCHKRFCFFM-CCZBSFLLSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)N3[C@@H](C(C([C@@H]3CO)O)O)CO |
Computed by PubChem (NCBI)