Products 132205-60-8
CAS 132205-60-8 is the registry number for 2-(1-(Aminomethyl)-1,2,3,4-tetrahydronaphthalen-1-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetic acid;hydrochloride (CAS 132205-60-8) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: 2-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetic acid;hydrochloride. InChIKey: OVNQLHFXVXTWFT-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO2 |
|---|---|
| Molecular weight | 255.74 g/mol |
| IUPAC name | 2-[1-(aminomethyl)-3,4-dihydro-2H-naphthalen-1-yl]acetic acid;hydrochloride |
| InChIKey | OVNQLHFXVXTWFT-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2C(C1)(CC(=O)O)CN.Cl |
Computed by PubChem (NCBI)