CAS 132209-79-1 appears in our catalog under these names: Ethyl 2-chloro-1,8-naphthyridine-3-carboxylate, 95%, 1,8-Naphthyridine-3-carboxylic acid, 2-chloro-, ethyl ester, >97%, >97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
Ethyl 2-chloro-1,8-naphthyridine-3-carboxylate (CAS 132209-79-1) is a chemical compound with the molecular formula C11H9ClN2O2 and a molecular weight of 236.65 g/mol. IUPAC name: ethyl 2-chloro-1,8-naphthyridine-3-carboxylate. InChIKey: JZSQZPZZJPEXND-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O2 |
|---|---|
| Molecular weight | 236.65 g/mol |
| IUPAC name | ethyl 2-chloro-1,8-naphthyridine-3-carboxylate |
| InChIKey | JZSQZPZZJPEXND-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C(=C1)C=CC=N2)Cl |
Computed by PubChem (NCBI)