CAS 13224-95-8 is the registry number for (2R,3R,4S,5R,6R)-6-(Hydroxymethyl)-4-methoxytetrahydro-2H-pyran-2,3,5-triol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-methoxyoxane-2,3,5-triol (CAS 13224-95-8) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 194.18 g/mol. IUPAC name: (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-methoxyoxane-2,3,5-triol. InChIKey: SCBBSJMAPKXHAH-BNWJMWRWSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-4-methoxyoxane-2,3,5-triol |
| InChIKey | SCBBSJMAPKXHAH-BNWJMWRWSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1O)O)CO)O |
Computed by PubChem (NCBI)