Products 478529-34-9
CAS 478529-34-9 is the registry number for 3-O-Methyl-D-glucose-13C, 99.0%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 50 mg, 25 mg.
(3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxyoxane-2,3,5-triol (CAS 478529-34-9) is a chemical compound with the molecular formula C7H14O6 and a molecular weight of 195.18 g/mol. IUPAC name: (3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxyoxane-2,3,5-triol. InChIKey: SCBBSJMAPKXHAH-PFXJGHEHSA-N.
| Molecular formula | C7H14O6 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | (3R,4S,5R,6R)-6-(hydroxy(113C)methyl)-4-methoxyoxane-2,3,5-triol |
| InChIKey | SCBBSJMAPKXHAH-PFXJGHEHSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](OC([C@@H]1O)O)[13CH2]O)O |
Computed by PubChem (NCBI)