CAS 132255-83-5 is the registry number for (E)-Trimethylsilyl N-(trimethylsilyl)acetimidate. Offered by: Biosynth. Available pack sizes: 0,5kg, 0,25kg.
Trimethylsilyl N-trimethylsilylethanimidate (CAS 132255-83-5) is a chemical compound with the molecular formula C8H21NOSi2 and a molecular weight of 203.43 g/mol. IUPAC name: trimethylsilyl N-trimethylsilylethanimidate. InChIKey: SIOVKLKJSOKLIF-UHFFFAOYSA-N.
| Molecular formula | C8H21NOSi2 |
|---|---|
| Molecular weight | 203.43 g/mol |
| IUPAC name | trimethylsilyl N-trimethylsilylethanimidate |
| InChIKey | SIOVKLKJSOKLIF-UHFFFAOYSA-N |
| SMILES | CC(=N[Si](C)(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)