CAS 203784-65-0 appears in our catalog under these names: N,O-Bis(trimethyl-d9-silyl)acetamide >90%, N,O-Bis(trimethyl-d9-silyl)acetamide, 99 atom % D, min 94% Chemical Purity, Trimethylsilyl N-(trimethylsilyl)acetimidate-d18. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 0,25g, 0,1g, 10 mg, 5 mg.
Tris(trideuteriomethyl)silyl N-[tris(trideuteriomethyl)silyl]ethanimidate (CAS 203784-65-0) is a chemical compound with the molecular formula C8H21NOSi2 and a molecular weight of 221.54 g/mol. IUPAC name: tris(trideuteriomethyl)silyl N-[tris(trideuteriomethyl)silyl]ethanimidate. InChIKey: SIOVKLKJSOKLIF-WNBQGSQPSA-N.
| Molecular formula | C8H21NOSi2 |
|---|---|
| Molecular weight | 221.54 g/mol |
| IUPAC name | tris(trideuteriomethyl)silyl N-[tris(trideuteriomethyl)silyl]ethanimidate |
| InChIKey | SIOVKLKJSOKLIF-WNBQGSQPSA-N |
| SMILES | [2H]C([2H])([2H])[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])N=C(C)O[Si](C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)