CAS 1322605-09-3 is the registry number for 1-Isobutyl-1h-indol-4-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(2-methylpropyl)indol-4-amine;hydrochloride (CAS 1322605-09-3) is a chemical compound with the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. IUPAC name: 1-(2-methylpropyl)indol-4-amine;hydrochloride. InChIKey: QZGMMCCPYJYNAY-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | 1-(2-methylpropyl)indol-4-amine;hydrochloride |
| InChIKey | QZGMMCCPYJYNAY-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=CC2=C(C=CC=C21)N.Cl |
Computed by PubChem (NCBI)