CAS 942148-13-2 appears in our catalog under these names: 2-(1H-Indol-3-yl)-2-methylpropan-1-amine hydrochloride, 95%, 2-(1H-Indol-3-yl)-2-methylpropan-1-amine hydrochloride 95%, 2-(1H-Indol-3-yl)-2-methylpropan-1-amine hydrochloride, 96%, 2-(1H-Indol-3-yl)-2-methylpropan-1-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-(1H-indol-3-yl)-2-methylpropan-1-amine;hydrochloride (CAS 942148-13-2) is a chemical compound with the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. IUPAC name: 2-(1H-indol-3-yl)-2-methylpropan-1-amine;hydrochloride. InChIKey: KNKHXRCEFPEPTO-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN2 |
|---|---|
| Molecular weight | 224.73 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)-2-methylpropan-1-amine;hydrochloride |
| InChIKey | KNKHXRCEFPEPTO-UHFFFAOYSA-N |
| SMILES | CC(C)(CN)C1=CNC2=CC=CC=C21.Cl |
Computed by PubChem (NCBI)