CAS 13228-52-9 is the registry number for 3-Bromo-1-(3,4-dichlorophenyl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-bromo-1-(3,4-dichlorophenyl)pyrrolidin-2-one (CAS 13228-52-9) is a chemical compound with the molecular formula C10H8BrCl2NO and a molecular weight of 308.98 g/mol. IUPAC name: 3-bromo-1-(3,4-dichlorophenyl)pyrrolidin-2-one. InChIKey: VUXMKBJIESFMLX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrCl2NO |
|---|---|
| Molecular weight | 308.98 g/mol |
| IUPAC name | 3-bromo-1-(3,4-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | VUXMKBJIESFMLX-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)