CAS 1343959-33-0 appears in our catalog under these names: 3-Bromo-1-(2,4-dichlorophenyl)pyrrolidin-2-one, 95%, 3-Bromo-1-(2,4-dichlorophenyl)pyrrolidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-1-(2,4-dichlorophenyl)pyrrolidin-2-one (CAS 1343959-33-0) is a chemical compound with the molecular formula C10H8BrCl2NO and a molecular weight of 308.98 g/mol. IUPAC name: 3-bromo-1-(2,4-dichlorophenyl)pyrrolidin-2-one. InChIKey: XJBYHOVONSVERO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrCl2NO |
|---|---|
| Molecular weight | 308.98 g/mol |
| IUPAC name | 3-bromo-1-(2,4-dichlorophenyl)pyrrolidin-2-one |
| InChIKey | XJBYHOVONSVERO-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)C1Br)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)