Products 1323251-06-4
CAS 1323251-06-4 appears in our catalog under these names: 4-Hydroxy Mepivacaine-d3, 4-Hydroxy Mepivacaine-d3, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: 1 mg, 10 mg, 10mg, 1mg.
N-(4-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide (CAS 1323251-06-4) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 265.37 g/mol. IUPAC name: N-(4-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide. InChIKey: FBFWYQLEUFLRTK-HPRDVNIFSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 265.37 g/mol |
| IUPAC name | N-(4-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide |
| InChIKey | FBFWYQLEUFLRTK-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCCC1C(=O)NC2=C(C=C(C=C2C)O)C |
Computed by PubChem (NCBI)