CAS 13234-79-2 appears in our catalog under these names: 2-Phenylbenzamide, 2-Phenylbenzamide, 95%, Biphenyl-2-carboxamide, 95-<97%, [1,1'-BIPHENYL]-2-CARBOXAMIDE, 97%, [1,1'-biphenyl]-2-carboxamide, 95%, 95%. Offered by: TRC, Biosynth, Combi-blocks, Hoffman Fine Chemicals, Fluorochem. Available pack sizes: 5g, 50g, 100g, 250g, 250mg, 1g, 2,5g, 10g.
2-phenylbenzamide (CAS 13234-79-2) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: 2-phenylbenzamide. InChIKey: GTKIGDZXPDCIKR-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 2-phenylbenzamide |
| InChIKey | GTKIGDZXPDCIKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(=O)N |
Computed by PubChem (NCBI)