CAS 132390-68-2 is the registry number for 3-Formyl-N,N-dimethylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-formyl-N,N-dimethylbenzenesulfonamide (CAS 132390-68-2) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: 3-formyl-N,N-dimethylbenzenesulfonamide. InChIKey: VHANLUOARPNVIY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S |
|---|---|
| Molecular weight | 213.26 g/mol |
| IUPAC name | 3-formyl-N,N-dimethylbenzenesulfonamide |
| InChIKey | VHANLUOARPNVIY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC=CC(=C1)C=O |
Computed by PubChem (NCBI)